CAS 7681-67-6
:propionylpromazine hydrochloride
Description:
Propionylpromazine hydrochloride is a chemical compound that belongs to the class of phenothiazine derivatives, primarily used for its antipsychotic and sedative properties. It is characterized by its ability to act as a dopamine antagonist, which contributes to its therapeutic effects in managing various psychiatric disorders. The compound is typically encountered as a hydrochloride salt, enhancing its solubility in water, which is advantageous for pharmaceutical formulations. Propionylpromazine hydrochloride exhibits a moderate to high lipophilicity, allowing it to cross biological membranes effectively. Its pharmacological profile includes sedative, antiemetic, and anxiolytic effects, making it useful in clinical settings. The compound is also known for its potential side effects, which may include sedation, hypotension, and extrapyramidal symptoms, necessitating careful monitoring during use. As with many medications, the specific characteristics, including stability and reactivity, can be influenced by environmental factors such as pH and temperature. Overall, propionylpromazine hydrochloride is a significant compound in the realm of psychopharmacology, with a well-defined role in treating mental health conditions.
Formula:C20H25ClN2OS
InChI:InChI=1/C20H24N2OS.ClH/c1-4-18(23)15-10-11-20-17(14-15)22(13-7-12-21(2)3)16-8-5-6-9-19(16)24-20;/h5-6,8-11,14H,4,7,12-13H2,1-3H3;1H
SMILES:CCC(=O)c1ccc2c(c1)N(CCCN(C)C)c1ccccc1S2.Cl
Synonyms:- 1-{10-[3-(dimethylamino)propyl]-10H-phenothiazin-2-yl}propan-1-one hydrochloride (1:1)
- Propionylpromazine, Hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Propionylpromazine (hydrochloride)
CAS:Formula:C20H25ClN2OSPurity:95.01%Color and Shape:SolidMolecular weight:376.9433Propionylpromazine hydrochloride
CAS:Propionylpromazine hydrochloridePurity:≥98%Molecular weight:376.94g/molPropionylpromazine Hydrochloride
CAS:Propionylpromazine HydrochloridePurity:98%Molecular weight:376.94g/molPropionylpromazine hydrochloride
CAS:Formula:C20H24N2OS·ClHColor and Shape:NeatMolecular weight:376.94Propionylpromazine hydrochloride
CAS:Propionylpromazine hydrochloride (Propiopromazine hydrochloride) is a dopamine receptor D2 (DRD2) antagonist.Formula:C20H25ClN2OSPurity:99.17%Color and Shape:SolidMolecular weight:376.94Propionylpromazine Hydrochloride
CAS:Applications Propionylpromazine Hydrochloride is a tranquilizer used in veterinary medicine.
References Meis, P., et al.: Obstet. Gynecol., 105, 1128 (2005), Iurisci, I., et al.: Cancer Res., 66, 10720 (2006), Liu, A., et al.: Nat. Chem. Biol., 3, 630 (2007),Formula:C20H24N2OS·ClHColor and Shape:Yellowish CrystallineMolecular weight:376.941-(10-(3-(DIMETHYLAMINO)PROPYL)-10H-PHENOTHIAZIN-2-YL)PROPAN-1-ONE HYDROCHLORIDE
CAS:Purity:98%Molecular weight:376.9400024






