CymitQuimica logo

CAS 76812-43-6

:

2-ethoxy-2-oxoethyl [1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetate

Description:
2-Ethoxy-2-oxoethyl [1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetate, with the CAS number 76812-43-6, is a synthetic organic compound that belongs to the class of indole derivatives. This compound features a complex structure characterized by an indole ring, which is a bicyclic structure containing a benzene fused to a pyrrole. The presence of the 4-chlorobenzoyl group introduces a halogen substituent, which can influence the compound's reactivity and biological activity. The ethoxy and oxoethyl functional groups contribute to its solubility and potential interactions in biological systems. Generally, compounds of this nature may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the compound's purity and the conditions under which it is studied. As with many synthetic organic compounds, safety data and handling precautions are essential due to potential toxicity or reactivity.
Formula:C23H22ClNO6
InChI:InChI=1/C23H22ClNO6/c1-4-30-22(27)13-31-21(26)12-18-14(2)25(20-10-9-17(29-3)11-19(18)20)23(28)15-5-7-16(24)8-6-15/h5-11H,4,12-13H2,1-3H3
SMILES:CCOC(=O)COC(=O)Cc1c(C)n(c2ccc(cc12)OC)C(=O)c1ccc(cc1)Cl
Synonyms:
  • 1H-Indole-3-acetic acid, 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-, 2-ethoxy-2-oxoethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.