CymitQuimica logo

CAS 76820-35-4

:

5-Amino-N1,N3-bis(2,3-dihydroxypropyl)-1,3-benzenedicarboxamide

Description:
5-Amino-N1,N3-bis(2,3-dihydroxypropyl)-1,3-benzenedicarboxamide, with the CAS number 76820-35-4, is a chemical compound characterized by its structure, which includes an aromatic benzene ring substituted with two carboxamide groups and two 2,3-dihydroxypropyl side chains. This compound is notable for its potential applications in various fields, including pharmaceuticals and materials science, due to its functional groups that can participate in hydrogen bonding and other interactions. The presence of amino and hydroxyl groups suggests that it may exhibit good solubility in polar solvents and could engage in biochemical interactions, making it of interest in medicinal chemistry. Additionally, the compound's ability to form complexes with metal ions or other biomolecules could be explored for therapeutic or diagnostic purposes. Its stability, reactivity, and specific applications would depend on the conditions under which it is used, including pH, temperature, and the presence of other chemical species.
Formula:C14H21N3O6
InChI:InChI=1S/C14H21N3O6/c15-10-2-8(13(22)16-4-11(20)6-18)1-9(3-10)14(23)17-5-12(21)7-19/h1-3,11-12,18-21H,4-7,15H2,(H,16,22)(H,17,23)
InChI key:InChIKey=XOZGAPXHJKSZCU-UHFFFAOYSA-N
SMILES:C(NCC(CO)O)(=O)C1=CC(C(NCC(CO)O)=O)=CC(N)=C1
Synonyms:
  • 1,3-Benzenedicarboxamide, 5-amino-N,N′-bis(2,3-dihydroxypropyl)-
  • 1,3-Benzenedicarboxamide, 5-amino-N1,N3-bis(2,3-dihydroxypropyl)-
  • 5-Amino-N1,N3-bis(2,3-dihydroxypropyl)-1,3-benzenedicarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.