CAS 76823-94-4

methyl 3-{[(2-carbamimidamido-1,3-thiazol-4-yl)methyl]sulfanyl}propanimidoate

Description:

Methyl 3-{[(2-carbamimidamido-1,3-thiazol-4-yl)methyl]sulfanyl}propanimidoate, with the CAS number 76823-94-4, is a chemical compound characterized by its complex structure, which includes a thiazole ring and a carbamimidamide functional group. This compound typically exhibits properties associated with both thiazoles and amides, such as potential biological activity, including antimicrobial or antitumor effects, due to the presence of the thiazole moiety. The sulfanyl group suggests possible reactivity in nucleophilic substitution reactions, while the methyl ester functionality may influence its solubility and reactivity in various solvents. The presence of multiple functional groups indicates that this compound could participate in a range of chemical reactions, making it of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is studied. Further research would be necessary to fully elucidate its properties and potential applications.

Formula: C₉H₁₅N₅OS₂

InChI: InChI=1/C9H15N5OS2/c1-15-7(10)2-3-16-4-6-5-17-9(13-6)14-8(11)12/h5,10H,2-4H2,1H3,(H4,11,12,13,14)

SMILES: COC(=N)CCSCc1csc(n1)NC(=N)N

Dediaminosulfonyl Hydroxymethyl Famotidine

Controlled Product

CAS: 76823-94-4

Formula: C₉H₁₅N₅OS₂

Color and Shape: Neat

Molecular weight: 273.37

Ref: TR-D227200

Famotidine Methoxy Impurity

CAS: 76823-94-4

Formula: C₉H₁₅N₅OS₂

Molecular weight: 273.37

Ref: ST-EA-CP-F9014