CAS 76824-86-7
:6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid
Description:
6,7-Dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid is a chemical compound characterized by its complex bicyclic structure, which includes a tetrahydroisoquinoline moiety. This compound features two methoxy groups at the 6 and 7 positions, contributing to its unique chemical properties and potential biological activity. The presence of a carboxylic acid functional group at the 3 position enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. The compound is of interest in medicinal chemistry due to its structural similarity to various alkaloids and its potential pharmacological applications. Its CAS number, 76824-86-7, allows for precise identification in chemical databases. As with many organic compounds, its properties such as melting point, boiling point, and solubility can vary based on environmental conditions and the presence of other substances. Further research is often necessary to fully elucidate its biological activity and potential therapeutic uses.
Formula:C12H15NO4
InChI:InChI=1/C12H15NO4/c1-16-10-4-7-3-9(12(14)15)13-6-8(7)5-11(10)17-2/h4-5,9,13H,3,6H2,1-2H3,(H,14,15)
SMILES:COc1cc2CC(C(=O)O)NCc2cc1OC
Synonyms:- 3-Isoquinolinecarboxylic Acid, 1,2,3,4-Tetrahydro-6,7-Dimethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.