CymitQuimica logo

CAS 76824-93-6

:

7-hydroxy-6-methoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid

Description:
7-Hydroxy-6-methoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid, with the CAS number 76824-93-6, is a chemical compound that belongs to the class of isoquinoline derivatives. This substance features a tetrahydroisoquinoline core, which is characterized by a bicyclic structure containing a nitrogen atom. The presence of hydroxyl (-OH) and methoxy (-OCH3) functional groups contributes to its potential biological activity, as these groups can influence solubility, reactivity, and interaction with biological targets. The carboxylic acid (-COOH) group enhances its acidity and can facilitate interactions in biochemical pathways. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in neuropharmacology, given the known effects of isoquinoline derivatives on the central nervous system. However, specific studies would be necessary to elucidate its precise biological activities and therapeutic potential.
Formula:C11H13NO4
InChI:InChI=1/C11H13NO4/c1-16-10-4-6-2-8(11(14)15)12-5-7(6)3-9(10)13/h3-4,8,12-13H,2,5H2,1H3,(H,14,15)
SMILES:COc1cc2CC(C(=O)O)NCc2cc1O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.