CymitQuimica logo

CAS 76835-17-1

:

Piperazine, 1-(3,4-dichlorophenyl)-, hydrochloride (1:2)

Description:
Piperazine, 1-(3,4-dichlorophenyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. The presence of the 3,4-dichlorophenyl group indicates that it has two chlorine atoms substituted on the phenyl ring, contributing to its biological activity and potential pharmacological properties. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, particularly in pharmaceuticals. This compound may exhibit properties such as anxiolytic, antidepressant, or antipsychotic effects, making it of interest in medicinal chemistry. Its molecular structure allows for interactions with neurotransmitter systems, which can influence mood and behavior. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or side effects. Overall, Piperazine, 1-(3,4-dichlorophenyl)-, hydrochloride (1:2) represents a significant compound in the study of psychoactive drugs and their mechanisms of action.
Formula:C10H12Cl2N2·2ClH
InChI:InChI=1S/C10H12Cl2N2.2ClH/c11-9-2-1-8(7-10(9)12)14-5-3-13-4-6-14;;/h1-2,7,13H,3-6H2;2*1H
InChI key:InChIKey=VADUZJRSQFZLPH-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1Cl)N2CCNCC2.Cl
Synonyms:
  • 1-(3,4-Dichlorophenyl)piperazine hydrochloride
  • 4-(3,4-dichlorophenyl)piperazin-1-ium chloride
  • Piperazine, 1-(3,4-dichlorophenyl)-, dihydrochloride
  • Piperazine, 1-(3,4-dichlorophenyl)-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.