CymitQuimica logo

CAS 768358-04-9

:

3-[(2-fluorophenoxy)methyl]piperidine

Description:
3-[(2-Fluorophenoxy)methyl]piperidine is a chemical compound characterized by its piperidine core, which is a six-membered ring containing five carbon atoms and one nitrogen atom. The compound features a 2-fluorophenoxy group, indicating the presence of a fluorine atom on a phenyl ring that is ether-linked to the piperidine. This structure contributes to its potential biological activity, as the fluorine atom can influence the compound's lipophilicity and binding properties. The presence of the piperidine moiety often suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various neurological or psychiatric conditions. The compound's molecular interactions, solubility, and stability can be influenced by the substituents on the piperidine and phenyl rings. Additionally, the compound's CAS number, 768358-04-9, allows for its identification in chemical databases, facilitating research and development in various scientific fields, including drug discovery and organic synthesis.
Formula:C12H16FNO
InChI:InChI=1/C12H16FNO/c13-11-5-1-2-6-12(11)15-9-10-4-3-7-14-8-10/h1-2,5-6,10,14H,3-4,7-9H2
SMILES:c1ccc(c(c1)F)OCC1CCCNC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.