CAS 768358-61-8

4-[3-(1H-Imidazol-5-yl)propyl]piperidine

Description:

4-[3-(1H-Imidazol-5-yl)propyl]piperidine, with the CAS number 768358-61-8, is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing ring. This compound features a propyl chain that is substituted with an imidazole ring, specifically at the 3-position of the propyl group. The imidazole moiety contributes to the compound's potential biological activity, as imidazole derivatives are often involved in various pharmacological applications, including acting as ligands for receptors or enzymes. The presence of both the piperidine and imidazole structures suggests that this compound may exhibit properties such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. Additionally, the compound's structure may allow for interactions with biological targets, making it of interest in medicinal chemistry and drug development. Overall, 4-[3-(1H-Imidazol-5-yl)propyl]piperidine represents a versatile scaffold for further exploration in chemical and pharmaceutical research.

Formula: C₁₁H₁₉N₃

InChI: InChI=1S/C11H19N3/c1(3-11-8-13-9-14-11)2-10-4-6-12-7-5-10/h8-10,12H,1-7H2,(H,13,14)

InChI key: InChIKey=YPGRNKJNOSUCLY-UHFFFAOYSA-N

SMILES: C(CCC1CCNCC1)C2=CN=CN2

Synonyms:

• Piperidine, 4-[3-(1H-imidazol-5-yl)propyl]-
• VUF 5681
• Piperidine, 4-[3-(1H-imidazol-4-yl)propyl]-
• 4-[3-(1H-Imidazol-5-yl)propyl]piperidine