CAS 76837-94-0
:dipotassium (2E,7E)-1,9-dinitrilo-4,6-dithia-2,8-diazanona-2,7-diene-3,7-bis(thiolate)
Description:
Dipotassium (2E,7E)-1,9-dinitrilo-4,6-dithia-2,8-diazanona-2,7-diene-3,7-bis(thiolate), with CAS number 76837-94-0, is a complex chemical compound characterized by its unique structure that includes multiple functional groups such as nitriles, thiols, and a diazine framework. This compound features a dithiolate structure, which contributes to its potential applications in coordination chemistry and materials science. The presence of potassium ions indicates that it is a salt, likely enhancing its solubility in polar solvents. The compound's diene configuration suggests it may exhibit interesting electronic properties, potentially making it useful in organic synthesis or as a ligand in metal coordination complexes. Additionally, the thiolate groups may impart stability and reactivity, allowing for various interactions with metal ions. Overall, this compound's intricate structure and functional diversity make it a subject of interest in both theoretical and applied chemistry.
Formula:C5H2K2N4S4
InChI:InChI=1/C5H4N4S4.2K/c6-1-8-4(10)12-3-13-5(11)9-2-7;;/h3H2,(H,8,10)(H,9,11);;/q;2*+1/p-2
SMILES:C(#N)N=C(S)SCSC(=NC#N)S.K.K
Synonyms:- Cyanamide, N,N'-[methylenebis[thio[(E)-mercaptomethylidyne]]]bis-, potassium salt (1:2)
- Dipotassium (2E,7E)-1,9-dinitrilo-4,6-dithia-2,8-diazanona-2,7-diene-3,7-bis(thiolate)
- METHYLENEBIS(CYANIMIDODITHIOCARBONIC ACID)-S,S-DIPOTASSIUM SALT
- Methylenebis-(cyanoimidodithiocarbonic acid) S,S-dipotassium salt
- Methylenebis(cyanimidodithiocarbonic acid)-S,S-
- S,S-Methylenebis(cyanimidodithiocarbonicacid)dipotassiumsalt
- dipotassium N-cyano-1-[[[cyanoimino(sulfido)methyl]thio]methylthio]methanimidothioate
- dipotassium,N-cyano-1-[(N-cyano-C-sulfidocarbonimidoyl)sulfanylmethylsulfanyl]methanimidothioate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methylenebis(cyanimidodithiocarbonic acid)-S,S-dipotassium salt
CAS:Formula:C5H2K2N4S4Molecular weight:324.54
