CAS 76847-71-7
:3-{7-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-4-oxo-8-propyl-4H-chromen-2-yl}propanoic acid
Description:
The chemical substance known as 3-{7-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-4-oxo-8-propyl-4H-chromen-2-yl}propanoic acid, with the CAS number 76847-71-7, is a complex organic compound characterized by its multi-functional structure. It features a chromenone core, which is a bicyclic structure known for its aromatic properties and biological activity. The presence of various functional groups, including an acetyl group, hydroxyl group, and propyl chains, suggests potential for diverse interactions in biological systems. This compound may exhibit properties such as antioxidant activity, anti-inflammatory effects, or other pharmacological activities, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity would depend on the specific conditions, including pH and solvent environment. The intricate arrangement of substituents also indicates potential for specific binding interactions, which could be explored in drug design or therapeutic applications. Overall, this compound represents a significant example of synthetic organic chemistry with potential implications in pharmacology and biochemistry.
Formula:C29H34O8
InChI:InChI=1/C29H34O8/c1-4-7-22-25(12-10-20(18(3)30)28(22)34)35-15-6-16-36-26-13-11-21-24(31)17-19(9-14-27(32)33)37-29(21)23(26)8-5-2/h10-13,17,34H,4-9,14-16H2,1-3H3,(H,32,33)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
FPL-59257
CAS:FPL-59257 is a leukotriene antagonist that has been shown to abolish cough response & partly inhibit bronchoconstriction produced by leukotrienes C & D.Formula:C29H34O8Color and Shape:SolidMolecular weight:510.58
