CAS 76849-79-1

5-(4-methoxyphenyl)pyrazin-2(1H)-one

Description:

5-(4-Methoxyphenyl)pyrazin-2(1H)-one, identified by its CAS number 76849-79-1, is an organic compound featuring a pyrazinone core substituted with a methoxyphenyl group. This compound typically exhibits characteristics common to pyrazinones, such as a planar structure that allows for potential π-π stacking interactions. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and biological activity. Pyrazinones are known for their diverse applications, including in pharmaceuticals and agrochemicals, often exhibiting antimicrobial and anti-inflammatory properties. The specific substitution pattern of the methoxyphenyl group can affect the compound's electronic properties, potentially impacting its interaction with biological targets. Additionally, the compound may display moderate stability under standard conditions, but like many organic compounds, it should be handled with care to avoid degradation. Overall, 5-(4-methoxyphenyl)pyrazin-2(1H)-one represents a versatile structure with potential utility in various chemical and biological applications.

Formula: C₁₁H₁₀N₂O₂

InChI: InChI=1/C11H10N2O2/c1-15-9-4-2-8(3-5-9)10-6-13-11(14)7-12-10/h2-7H,1H3,(H,13,14)

SMILES: COc1ccc(cc1)c1c[nH]c(=O)cn1

Synonyms:

• 2(1H)-pyrazinone, 5-(4-methoxyphenyl)-
• 5-(4-Methoxyphenyl)-2(1H)-pyrazinon
• 5-(4-Methoxyphenyl)-2(1H)-pyrazinone
• 5-(4-Methoxyphenyl)pyrazin-2(1H)-one