CAS 76857-14-2
:3-Hydroxy-5-mercapto-4-isothiazolecarboxylic acid trisodium salt
Description:
3-Hydroxy-5-mercapto-4-isothiazolecarboxylic acid trisodium salt, with CAS number 76857-14-2, is a chemical compound characterized by its unique isothiazole structure, which incorporates both hydroxyl and mercapto functional groups. This compound is typically encountered as a sodium salt, enhancing its solubility in aqueous environments. It exhibits properties such as chelation, allowing it to bind metal ions, which can be beneficial in various applications, including agriculture as a fungicide or in analytical chemistry for metal ion detection. The presence of the mercapto group contributes to its reactivity, making it a potential candidate for various chemical reactions. Additionally, the compound may display antioxidant properties due to the presence of the thiol group, which can scavenge free radicals. Its trisodium salt form suggests a high degree of ionization, which can influence its behavior in biological systems and its interaction with other substances. Overall, this compound's unique structural features and functional groups make it versatile for multiple applications in both industrial and research settings.
Formula:C4H3NNa3O3S2
InChI:InChI=1/C4H3NO3S2.3Na/c6-2-1(3(7)8)4(9)10-5-2;;;/h9H,(H,5,6)(H,7,8);;;/q;3*+1
SMILES:c1(c(=O)[nH]sc1S)C(=O)O.[Na].[Na].[Na]
Synonyms:- Hmit
- 3-Hydroxy-4-Carboxyl-5-Mercapto Isothiazole Trisodium Salt
- 2,3-Dihydro-5-Mercapto-3-Oxo-4-Isothiazolecarboxylic Acid Trisodium Salt
- Trisodium 4-Carboxy-5-Mercapto-3-Hydroxy-Isothiazole
- Hmit:3-Hydroxy-5-Mercapto-4-Isothiazolecarboxylic Acid Trisodium Salt
- 3-Hydroxy-4-Carboxy-5-Mercaptoisothiazoletrisodiumsalt
- 4-Isothiazolecarboxylic Acid, 3-Hydroxy-5-Mercapto-, Sodium Salt (1:3)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Isothiazolecarboxylic acid, 2,3-dihydro-5-mercapto-3-oxo-, trisodiumsalt
CAS:Formula:C4NNa3O3S2Purity:97%Color and Shape:SolidMolecular weight:243.1472,3-Dihydro-5-mercapto-3-oxo-4-isothiazolecarboxylic Acid Trisodium Salt
CAS:Controlled ProductApplications 2,3-Dihydro-5-mercapto-3-oxo-4-isothiazolecarboxylic Acid Trisodium Salt, can be used in the synthesis of new cephamycin derivatives, that are antibacterial agents.
References Lee, Y.H., et al.: Yakhak /hoechi, 42, 364 (1998);Formula:C4NNa3O3S2Color and Shape:NeatMolecular weight:243.15

