CAS 7686-78-4
:1,1-Diethyl 2-ethenyl-1,1-cyclopropanedicarboxylate
Description:
1,1-Diethyl 2-ethenyl-1,1-cyclopropanedicarboxylate, with the CAS number 7686-78-4, is an organic compound characterized by its unique cyclopropane structure and the presence of two ethyl groups and a vinyl group. This compound features a cyclopropane ring that is substituted with two carboxylate ester groups, which contribute to its reactivity and potential applications in organic synthesis. The presence of the vinyl group enhances its ability to undergo polymerization and other reactions typical of alkenes. It is typically a colorless to pale yellow liquid with a characteristic odor. The compound is soluble in organic solvents, making it useful in various chemical reactions and applications, including as an intermediate in the synthesis of more complex molecules. Its reactivity, particularly in the presence of nucleophiles, allows for the formation of diverse derivatives, making it a valuable compound in synthetic organic chemistry. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C11H16O4
InChI:InChI=1/C11H16O4/c1-4-8-7-11(8,9(12)14-5-2)10(13)15-6-3/h4,8H,1,5-7H2,2-3H3
InChI key:InChIKey=UOQTXZICFVMERR-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1(C(OCC)=O)C(C=C)C1
Synonyms:- 1,1-Bis(ethoxycarbonyl)-2-vinylcyclopropane
- 1,1-Cyclopropanedicarboxylic acid, 2-ethenyl-, 1,1-diethyl ester
- 1,1-Cyclopropanedicarboxylic acid, 2-ethenyl-, diethyl ester
- 1,1-Cyclopropanedicarboxylic acid, 2-vinyl-, diethyl ester
- 1,1-Cyclopropanedicarboxylic acid, vinyl-, diethyl ester
- 1,1-Diethoxycarbonyl-2-vinylcyclopropane
- 1,1-Diethyl 2-ethenyl-1,1-cyclopropanedicarboxylate
- Diethyl 2-Ethenylcyclopropane-1,1-Dicarboxylate
- Diethyl 2-vinylcyclopropane-1,1-dicarboxylate
- 2-Ethenylcyclopropane-1,1-dicarboxylic acid diethyl ester
- 2,2-(3-Butene-1,2-diyl)malonic acid diethyl ester
- 2-VINYLCYCLOPROPANE-1,1-DICARBOXYLIC ACID DIETHYL ESTER
- 2-Vinyl-1,1-cyclopropanedicarboxylic acid diethyl ester
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Diethyl 2-vinylcyclopropane-1,1-dicarboxylate
CAS:Formula:C11H16O4Purity:97%Color and Shape:LiquidMolecular weight:212.2423Diethyl 2-Vinylcyclopropane-1,1-Dicarboxylate
CAS:Diethyl 2-Vinylcyclopropane-1,1-DicarboxylatePurity:99%Molecular weight:212.24g/molDIETHYL 2-VINYLCYCLOPROPANE-1,1-DICARBOXYLATE
CAS:Formula:C11H16O4Purity:97%Color and Shape:LiquidMolecular weight:212.2452-Vinylcyclopropane-1,1-dicarboxylic acid diethyl ester
CAS:2-Vinylcyclopropane-1,1-dicarboxylic acid diethyl ester (VCPD) is a molecule that is synthesized by the nucleophilic attack of an alcohol on the double bond of a cyclopropane ring. VCPD is used in the production of polymers and copolymers. VCPD can be copolymerized with other monomers such as styrene, chloromethylstyrene, acrylonitrile, vinyl acetate, vinyl chloride and butadiene to produce various types of polymers. The polymerization process involves three steps: initiation, propagation and termination. Initiation takes place when persulfate is added to VCPD and water at high temperature. The polymerization process ends when there are no more VCPD molecules available for reaction or when all the monomers have been consumed during the reaction.Formula:C11H16O4Purity:Min. 95%Molecular weight:212.24 g/mol



