CAS 76862-65-2
:conotoxin gi
Description:
Conotoxin Gi is a peptide toxin derived from the venom of certain cone snails, specifically from the species Conus geographus. It is classified as a conotoxin, which are small, disulfide-rich peptides that target various ion channels and receptors in the nervous system. Conotoxin Gi primarily acts as a selective inhibitor of the N-type voltage-gated calcium channels (Cav2.2), which play a crucial role in neurotransmitter release and pain signaling. This inhibition can lead to analgesic effects, making conotoxins of interest for pain management research. The structure of conotoxin Gi includes multiple disulfide bonds that contribute to its stability and biological activity. Due to its specificity and potency, conotoxin Gi is studied for potential therapeutic applications, particularly in the development of novel analgesics. However, its use is limited by the challenges associated with peptide drug delivery and potential side effects. Overall, conotoxin Gi exemplifies the complex interplay between natural products and pharmacology, highlighting the potential of venom-derived compounds in drug discovery.
Formula:C55H80N20O18S4
InChI:InChI=1/C55H80N20O18S4/c1-25-44(83)72-36-21-95-97-22-37(73-45(84)29(56)9-10-42(80)81)52(91)74-38(51(90)69-33(16-40(57)78)54(93)75-12-4-8-39(75)53(92)65-25)23-96-94-20-35(43(58)82)71-50(89)34(19-76)70-48(87)31(14-26-5-2-6-28(77)13-26)67-49(88)32(15-27-17-61-24-64-27)68-47(86)30(7-3-11-62-55(59)60)66-41(79)18-63-46(36)85/h2,5-6,13,17,24-25,29-39,76-77H,3-4,7-12,14-16,18-23,56H2,1H3,(H2,57,78)(H2,58,82)(H,61,64)(H,63,85)(H,65,92)(H,66,79)(H,67,88)(H,68,86)(H,69,90)(H,70,87)(H,71,89)(H,72,83)(H,73,84)(H,74,91)(H,80,81)(H4,59,60,62)/t25-,29-,30-,31-,32-,33-,34-,35-,36-,37-,38-,39-/m0/s1
SMILES:C[C@H]1C(=N[C@H]2CSSC[C@@H](C(=N[C@@H](CSSC[C@@H](C(=N)O)N=C([C@H](CO)N=C([C@H](Cc3cccc(c3)O)N=C([C@H](Cc3cnc[nH]3)N=C([C@H](CCCNC(=N)N)N=C(CN=C2O)O)O)O)O)O)C(=N[C@@H](CC(=N)O)C(=O)N2CCC[C@H]2C(=N1)O)O)O)N=C([C@H](CCC(=O)O)N)O)O
Synonyms:- a-Conotoxin GI, Conus geographus
- H-Glu-Cys-Cys-Asn-Pro-Ala-Cys-Gly-Arg-His-Tyr-Ser-Cys-NH2 (Disulfide bonds between Cys2 and Cys7/Cys3 and Cys13)
- Alpha-Conotoxin Gi
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Alpha-Conotoxin GI
CAS:A synthetic cone snail toxin, sourced from the marine snail, Conus geographus and can be applied as a blocker for the nicotinic acetylcholine receptor. This product is available as a 0.5mg vial with disulfide bonds between Cys2-Cys7 and Cys3-Cys13 and in the hydrochloride salt form.Formula:C55H80N20O18S4Purity:Min. 95%Molecular weight:1,437.6 g/molα-Conotoxin GI
CAS:α-conotoxin GI, a conopeptide isolated from the venom of the cone snail Conus geographus, is a competitive antagonist of the muscle-type nicotinic acetylcholine
Formula:C55H80N20O18S4Purity:98%Color and Shape:SolidMolecular weight:1437.61

