CAS 76863-28-0
:fluorescein-5-thiosemicarbazide
Description:
Fluorescein-5-thiosemicarbazide is a chemical compound characterized by its fluorescent properties, making it useful in various biological and chemical applications, particularly in fluorescence microscopy and as a tracer in biochemical assays. It is derived from fluorescein, a well-known fluorescent dye, modified with a thiosemicarbazide functional group. This modification enhances its reactivity and solubility in biological systems. The compound typically exhibits a bright green fluorescence when excited by ultraviolet or blue light, which is a hallmark of fluorescein derivatives. Its structure includes a thiosemicarbazide moiety, which can participate in various chemical reactions, including those involving nucleophilic attack, making it valuable in synthetic organic chemistry. Additionally, fluorescein-5-thiosemicarbazide may have applications in the development of fluorescent probes for detecting specific biomolecules or in the study of cellular processes. As with many chemical substances, safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C21H17N3O5S
InChI:InChI=1/C20H12O5.CH5N3S/c21-11-5-7-15-17(9-11)24-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)25-20;2-1(5)4-3/h1-10,21-22H;3H2,(H3,2,4,5)
SMILES:c1ccc2c(c1)C(=O)OC12c2ccc(cc2Oc2cc(ccc12)O)O.C(=N)(NN)S
Synonyms:- 5-[(hydrazinocarbonothioyl)amino]-2-(6-hydroxy-3-oxo-3H-xanthen-9-yl)benzoic acid
- hydrazinecarbothioamide - 3',6'-dihydroxy-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
FLUORESCEIN-5-THIOSEMICARBAZIDE
CAS:Formula:C21H15N3O5SPurity:95%Color and Shape:SolidMolecular weight:421.4259Fluorescein-5-thiosemicarbazide
CAS:Fluorescein-5-thiosemicarbazidePurity:≥95%Molecular weight:421.43g/molFluorescein-5-thiosemicarbazide hydrochloride
CAS:Fluorescein-5-thiosemicarbazide HCl is a fluorescent compound that has been used extensively as a dye in biological research. It is commonly used with other compounds to measure the transfer of resonance energy, the interaction between two molecules, or the solubility of one molecule in another. Fluorescein-5-thiosemicarbazide HCl can be used to measure cellulose because it reacts with hydroxyl groups on the surface of the material. The quantum yield for this compound is 0.06%.
Formula:C21H15N3O5S•HClPurity:Min. 95%Color and Shape:PowderMolecular weight:457.89 g/molFluorescein-5-thiosemicarbazide
CAS:Controlled ProductApplications Fluorescein-5-thiosemicarbazide (cas# 76863-28-0) is a useful research chemical.
Formula:C21H15N3O5SColor and Shape:NeatMolecular weight:421.426





