CAS 76865-42-4
:(4aR,12bR)-2,3,4,4a,7,8,12b,13-octahydro-1H-6-thia-13a-azabenzo[f]naphtho[1,2,3-cd]azulene
Description:
The chemical substance known as "(4aR,12bR)-2,3,4,4a,7,8,12b,13-octahydro-1H-6-thia-13a-azabenzo[f]naphtho[1,2,3-cd]azulene" with CAS number 76865-42-4 is a complex polycyclic compound featuring a unique arrangement of carbon, sulfur, and nitrogen atoms. Its structure includes multiple fused rings, which contribute to its stability and potential biological activity. The presence of a thia (sulfur-containing) moiety and an azabenzene (nitrogen-containing) component suggests that this compound may exhibit interesting chemical reactivity and pharmacological properties. The stereochemistry indicated by the (4aR,12bR) notation implies specific three-dimensional orientations that can influence its interactions with biological targets. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, detailed studies on its specific properties, such as solubility, melting point, and biological activity, would be necessary to fully understand its potential uses and implications in various fields.
Formula:C19H21NS
InChI:InChI=1/C19H21NS/c1-2-6-14-13(5-1)8-9-18-19-15(14)11-20-10-4-3-7-17(20)16(19)12-21-18/h1-2,5-6,12,15,17H,3-4,7-11H2/t15-,17-/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
QM 7184
CAS:QM 7184 is a thiophene analogue of taclamine with potent alpha-adrenoceptor blocking activity.Formula:C19H21NSColor and Shape:SolidMolecular weight:295.44
