CAS 76868-97-8
:5-[(2E)-but-2-enoyl]-4-methoxy-6-methyl-2H-pyran-2-one
Description:
5-[(2E)-but-2-enoyl]-4-methoxy-6-methyl-2H-pyran-2-one, also known by its CAS number 76868-97-8, is an organic compound characterized by its pyranone structure, which features a six-membered ring containing both oxygen and carbon atoms. This compound exhibits a conjugated system due to the presence of the but-2-enoyl group, contributing to its potential reactivity and stability. The methoxy and methyl substituents enhance its lipophilicity and may influence its biological activity. Pyranones are known for their diverse applications, including in pharmaceuticals and agrochemicals, due to their ability to participate in various chemical reactions, such as nucleophilic additions and cycloadditions. The compound's structural features suggest it may possess interesting properties, including potential antioxidant or antimicrobial activities, although specific biological data would be necessary to confirm these effects. Overall, this compound exemplifies the complexity and versatility of organic molecules in chemical and biological contexts.
Formula:C11H12O4
InChI:InChI=1/C11H12O4/c1-4-5-8(12)11-7(2)15-10(13)6-9(11)14-3/h4-6H,1-3H3/b5-4+
Synonyms:- 2H-Pyran-2-one, 4-methoxy-6-methyl-5-(1-oxo-2-butenyl)-, (E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Pyrenocine A, cytreopirone
CAS:Formula:C11H12O4Purity:81.24%Color and Shape:Whitish powderMolecular weight:208.0Pyrenocine A
CAS:Pyrenocine A, a fungal metabolite from P. terrestris, inhibits spore germination and seedling growth with various EC50/IC50 values.Formula:C11H12O4Color and Shape:SolidMolecular weight:208.213Pyrenocine A
CAS:Pyrenocine A is a mycotoxin, which is a secondary metabolite produced by certain fungi, specifically isolated from marine and terrestrial fungal sources such as the genus Aspergillus. With a unique molecular structure, Pyrenocine A exhibits potential antimicrobial properties. The mode of action is thought to involve the inhibition of protein synthesis and disruption of cellular processes, which can hinder the growth and proliferation of microorganisms.
Formula:C11H12O4Purity:Min. 95%Molecular weight:208.21 g/mol



