CAS 76877-34-4

N-{4-[7-(diethylamino)-4-methyl-2-oxo-2H-chromen-3-yl]phenyl}-2-iodoacetamide

Description:

N-{4-[7-(diethylamino)-4-methyl-2-oxo-2H-chromen-3-yl]phenyl}-2-iodoacetamide is a synthetic organic compound characterized by its complex structure, which includes a chromenone moiety, an amide functional group, and an iodine atom. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the diethylamino group suggests that it may have basic properties, which can influence its solubility and interaction with biological targets. The iodoacetamide group is known for its reactivity, particularly in forming covalent bonds with nucleophiles, making it useful in biochemical applications. The chromenone structure may impart additional pharmacological properties, such as antioxidant or anti-inflammatory effects. Overall, this compound's unique combination of functional groups and structural features positions it as a candidate for research in medicinal chemistry and drug development, particularly in the context of targeting specific biological pathways or mechanisms.

Formula: C₂₂H₂₃IN₂O₃

InChI: InChI=1/C22H23IN2O3/c1-4-25(5-2)17-10-11-18-14(3)21(22(27)28-19(18)12-17)15-6-8-16(9-7-15)24-20(26)13-23/h6-12H,4-5,13H2,1-3H3,(H,24,26)

SMILES: CCN(CC)c1ccc2c(C)c(c3ccc(cc3)NC(=O)CI)c(=O)oc2c1

Synonyms:

• Acetamide, N-[4-[7-(diethylamino)-4-methyl-2-oxo-2H-1-benzopyran-3-yl]phenyl]-2-iodo-
• 7-Diethylamino-3-[4-(iodoacetamido)phenyl]-4-methylcoumarin
• DCIA [7-DiethylaMino-3-(4-(iodoacetaMido)phenyl)-4-MethylcouMarin]
• 7-Diethylamino-3-((4'-(iodoacetyl)amino)phenyl)-4-methylcoumarin
• N-(4-(7-diethylamino 4-methylcoumarin-3-yl)phenyl)iodoacetamide

DCIA

CAS: 76877-34-4

DCIA

Purity: 97%

Molecular weight: 490.33g/mol

Ref: 54-OR1075507

DCIA

CAS: 76877-34-4

Ref: 7W-GW4157