CAS 76888-68-1
:3-(ethylamino)butan-1-ol
Description:
3-(Ethylamino)butan-1-ol, with the CAS number 76888-68-1, is an organic compound characterized by the presence of both an alcohol and an amine functional group. It features a butanol backbone, specifically a four-carbon chain, with an ethylamino group attached to the third carbon. This structure imparts both hydrophilic and hydrophobic properties, making it soluble in water and organic solvents. The compound is typically a colorless to pale yellow liquid and may have a mild amine-like odor. Its molecular structure allows for potential applications in pharmaceuticals, as it can serve as a building block for more complex molecules. Additionally, the presence of the hydroxyl (-OH) group contributes to its reactivity, enabling it to participate in various chemical reactions, such as esterification and amination. Safety data should be consulted for handling, as it may pose health risks if ingested or inhaled. Overall, 3-(ethylamino)butan-1-ol is a versatile compound with significant implications in organic synthesis and medicinal chemistry.
Formula:C6H15NO
InChI:InChI=1/C6H15NO/c1-3-7-6(2)4-5-8/h6-8H,3-5H2,1-2H3
SMILES:CCNC(C)CCO
Synonyms:- 1-Butanol, 3-(Ethylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
