CAS 7689-60-3

phenylmethionine

Description:

Phenylmethionine, also known as L-phenylmethionine, is an amino acid derivative characterized by the presence of both a phenyl group and a methionine structure. It is a non-proteinogenic amino acid, meaning it is not incorporated into proteins during translation. This compound features a sulfur atom in its structure, which is typical of methionine, contributing to its unique properties. Phenylmethionine is known for its potential role in various biochemical processes, including its involvement in the synthesis of certain neurotransmitters and its influence on metabolic pathways. It is often studied for its effects on plant growth and development, as well as its potential applications in pharmaceuticals and nutrition. The compound is typically found in a crystalline form and is soluble in water, making it accessible for various experimental and industrial applications. Its CAS number, 7689-60-3, is a unique identifier that facilitates the identification and study of this specific chemical substance in scientific literature and databases.

Formula: C₁₁H₁₅NO₂S

InChI: InChI=1/C11H15NO2S/c12-10(11(13)14)6-7-15-8-9-4-2-1-3-5-9/h1-5,10H,6-8,12H2,(H,13,14)

SMILES: c1ccc(cc1)CSCCC(C(=O)O)N

S-Benzyl-L-homocysteine

Controlled Product

CAS: 7689-60-3

Applications Intermediate in the preparation of L-(+)-Cystathionine.
References Adang, A., et al.: Biochem. J., 269, 47 (1990), Mortell, K., et al.: Bioorg. Med. Chem. Lett., 16, 1138 (2006), Grace, C., et al.: J. Med. Chem., 51, 2676 (2008),

Formula: C₁₁H₁₅NO₂S

Color and Shape: Neat

Molecular weight: 225.31

Ref: TR-B278800