CAS 76893-27-1

(1-hydroxy-2,2,5,5-tetramethyl-pyrrol-3-yl)methyl methanesulfonate

Description:

(1-hydroxy-2,2,5,5-tetramethyl-pyrrol-3-yl)methyl methanesulfonate, with CAS number 76893-27-1, is a chemical compound characterized by its unique structure that includes a pyrrole ring substituted with hydroxyl and tetramethyl groups, along with a methanesulfonate moiety. This compound is typically used in organic synthesis and may serve as a reagent or intermediate in various chemical reactions. Its functional groups contribute to its reactivity, making it useful in applications such as the formation of carbon-carbon bonds or in the synthesis of more complex molecules. The presence of the methanesulfonate group enhances its solubility in polar solvents, which can be advantageous in reaction conditions. Additionally, the steric hindrance provided by the tetramethyl groups can influence the compound's reactivity and selectivity in chemical transformations. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₀H₁₈NO₄S

InChI: InChI=1/C10H19NO4S/c1-9(2)6-8(7-15-16(5,13)14)10(3,4)11(9)12/h6,12H,7H2,1-5H3

SMILES: CC1(C)C=C(COS(=O)(=O)C)C(C)(C)N1O

Synonyms:

• 2,5-Dihydro-2,2,5,5-tetraMethyl-3-[[(Methylsulfonyl)oxy]Methyl]-1H-pyrrol-1-yloxy
• 1-OXYL-2,2,5,5-TETRAMETHYL-3-(METHANESULFONYLOXYMETHYL)PYRROLINE

1-Oxyl-2,2,5,5-tetramethyl-delta3-(methanesulfonyloxymethyl)pyrroline

Controlled Product

CAS: 76893-27-1

Stability Light and Moisture Sensitive
Applications A highly reactive spin-label.
References Qin, P.Z., et al.: Biochemistry, 40, 6929 (2001)

Formula: C₁₀H₁₈NO₄S

Color and Shape: Yellow To Dark Orange

Molecular weight: 248.32

Ref: TR-O872400