CymitQuimica logo

CAS 76893-32-8

:

3-(bromomethyl)-1-hydroxy-2,2,5,5-tetramethyl-pyrrole

Description:
3-(Bromomethyl)-1-hydroxy-2,2,5,5-tetramethyl-pyrrole is a chemical compound characterized by its unique pyrrole structure, which includes a bromomethyl group and a hydroxyl group. The presence of the bromomethyl group suggests that it can participate in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. The hydroxyl group contributes to its potential as a polar compound, influencing its solubility in various solvents. The tetramethyl substitution on the pyrrole ring enhances its steric bulk, which can affect its reactivity and stability. This compound may exhibit interesting properties such as potential biological activity, given the presence of functional groups that can interact with biological systems. Additionally, its molecular structure suggests that it could be involved in various chemical reactions, including those relevant to medicinal chemistry and materials science. Overall, 3-(bromomethyl)-1-hydroxy-2,2,5,5-tetramethyl-pyrrole is a versatile compound with potential applications in synthetic organic chemistry.
Formula:C9H16BrNO
InChI:InChI=1/C9H16BrNO/c1-8(2)5-7(6-10)9(3,4)11(8)12/h5,12H,6H2,1-4H3
SMILES:CC1(C)C=C(CBr)C(C)(C)N1O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • 3-Bromomethyl-2,5-dihydro-2,2,5,5-tetramethyl-1H-pyrrol-1-yloxy

    Controlled Product
    CAS:

    Applications Intermediate in the production of spin labelled compounds
    References Kalai, T., et al.: Bioorg. Med. Chem., 13, 2629 (2005), Kalai, T., et al.: Bioorg. Med. Chem., 14, 5510 (2006), Venditti, E., et al.: Free Rad. Biol. Med., 45, 345 (2008),

    Formula:C9H16BrNO
    Color and Shape:Neat
    Molecular weight:234.133

    Ref: TR-B685345

    5mg
    188.00€