CAS 76893-33-9
:2,5-Dihydro-3-(iodomethyl)-2,2,5,5-tetramethyl-1H-pyrrol-1-yloxy
Description:
2,5-Dihydro-3-(iodomethyl)-2,2,5,5-tetramethyl-1H-pyrrol-1-yloxy is a chemical compound characterized by its unique structure, which includes a pyrrole ring substituted with iodine and multiple methyl groups. This compound is notable for its potential applications in organic synthesis and as a radical initiator due to the presence of the stable nitroxide moiety. The iodine substituent enhances its reactivity, making it useful in various chemical transformations. The presence of the tetramethyl groups contributes to its steric bulk, which can influence its solubility and reactivity in different solvents. Additionally, the compound may exhibit interesting electronic properties due to the conjugation within the pyrrole ring. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Overall, 2,5-Dihydro-3-(iodomethyl)-2,2,5,5-tetramethyl-1H-pyrrol-1-yloxy is a versatile compound with potential utility in both academic research and industrial applications.
Formula:C9H15INO
InChI:InChI=1/C25H31F2IO5S/c1-5-20(31)33-25(21(32)34-12-28)13(2)8-15-16-10-18(26)17-9-14(29)6-7-22(17,3)24(16,27)19(30)11-23(15,25)4/h6-7,9,13,15-16,18-19,30H,5,8,10-12H2,1-4H3/t13-,15+,16+,18+,19+,22+,23+,24+,25+/m1/s1/i1D3
InChI key:InChIKey=JVIUFBAINCDPMA-UHFFFAOYSA-N
SMILES:CC1(C)C(CI)=CC(C)(C)N1[O]
Synonyms:- 1H-Pyrrol-1-yloxy, 2,5-dihydro-3-(iodomethyl)-2,2,5,5-tetramethyl-
- 2,5-Dihydro-3-(iodomethyl)-2,2,5,5-tetramethyl-1H-pyrrol-1-yloxy
- 3-IODOMETHYL-(1-OXY-2,2,5,5-TETRAMETHYLPYRROLINE)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3-Iodomethyl-(1-oxy-2,2,5,5-tetramethylpyrroline)
CAS:Controlled ProductStability Light, Temperature and Moisture Sensitive
Applications A thio-reactive spin label.
References Qin, P.Z., et al.: Biochemistry, 40, 6929 (2001)Formula:C9H15INOColor and Shape:NeatMolecular weight:280.133-Iodomethyl-(1-oxy-2,2,5,5-tetramethylpyrroline)-15N
CAS:Controlled ProductFormula:C9H15I15NOColor and Shape:NeatMolecular weight:281.119
