CAS 76893-48-6

2-(4-methoxyphenoxy)-3-nitropyridine

Description:

2-(4-Methoxyphenoxy)-3-nitropyridine, with the CAS number 76893-48-6, is an organic compound characterized by its pyridine ring substituted with both a methoxyphenoxy group and a nitro group. The presence of the methoxy group enhances its solubility in organic solvents and can influence its reactivity and biological activity. The nitro group, known for its electron-withdrawing properties, can affect the compound's electronic characteristics and reactivity, making it potentially useful in various chemical reactions and applications. This compound may exhibit biological activity, which is often explored in pharmaceutical research, particularly in the development of new drugs. Its structural features suggest potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability, solubility, and reactivity can vary depending on environmental conditions, such as pH and temperature. Overall, 2-(4-methoxyphenoxy)-3-nitropyridine is a compound of interest in both synthetic and medicinal chemistry due to its unique structural attributes.

Formula: C₁₂H₁₀N₂O₄

InChI: InChI=1/C12H10N2O4/c1-17-9-4-6-10(7-5-9)18-12-11(14(15)16)3-2-8-13-12/h2-8H,1H3

SMILES: COc1ccc(cc1)Oc1c(cccn1)N(=O)=O

2-(4-Methoxyphenoxy)-3-nitropyridine

CAS: 76893-48-6

2-(4-Methoxyphenoxy)-3-nitropyridine

Purity: 97%

Molecular weight: 246.22g/mol

Ref: 54-OR0582