CAS 76893-55-5

2-(2,3-dimethylphenoxy)-3-nitropyridine

Description:

2-(2,3-Dimethylphenoxy)-3-nitropyridine, with the CAS number 76893-55-5, is an organic compound characterized by its complex structure, which includes a pyridine ring substituted with both a nitro group and a phenoxy group derived from a dimethyl-substituted phenol. This compound typically exhibits a yellow to brown color and is likely to be a solid at room temperature. It is expected to be soluble in organic solvents due to the presence of the aromatic rings, while its solubility in water may be limited. The nitro group contributes to its potential reactivity, making it a candidate for various chemical reactions, including electrophilic substitutions. Additionally, the presence of multiple methyl groups can influence its physical properties, such as melting point and boiling point, as well as its overall stability. As with many nitro compounds, it may also exhibit some degree of toxicity, necessitating careful handling and appropriate safety measures in laboratory settings.

Formula: C₁₃H₁₂N₂O₃

InChI: InChI=1/C13H12N2O3/c1-9-5-3-7-12(10(9)2)18-13-11(15(16)17)6-4-8-14-13/h3-8H,1-2H3

2-(2,3-Dimethylphenoxy)-3-nitropyridine

CAS: 76893-55-5

2-(2,3-Dimethylphenoxy)-3-nitropyridine

Purity: ≥95%

Molecular weight: 244.25g/mol

Ref: 54-OR97975