CAS 76897-39-7
:3,4-Dihydro-4,4-dimethyl-2H-pyran-2-one
Description:
3,4-Dihydro-4,4-dimethyl-2H-pyran-2-one, with the CAS number 76897-39-7, is a cyclic organic compound characterized by its pyranone structure. It features a six-membered ring containing both oxygen and carbon atoms, specifically a pyran ring with a ketone functional group. This compound is typically colorless to pale yellow and may have a mild, sweet odor. It is soluble in organic solvents and exhibits moderate stability under standard conditions. The presence of the dimethyl groups contributes to its unique chemical properties, influencing its reactivity and potential applications. 3,4-Dihydro-4,4-dimethyl-2H-pyran-2-one is of interest in various fields, including organic synthesis and materials science, due to its potential as an intermediate in the production of pharmaceuticals and agrochemicals. Its reactivity can be attributed to the unsaturation in the ring, allowing for further chemical transformations. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C7H10O2
InChI:InChI=1S/C7H10O2/c1-7(2)3-4-9-6(8)5-7/h3-4H,5H2,1-2H3
InChI key:InChIKey=BBJQMPGDRXUFQM-UHFFFAOYSA-N
SMILES:CC1(C)CC(=O)OC=C1
Synonyms:- 2H-Pyran-2-one, 3,4-dihydro-4,4-dimethyl-
- 3,4-Dihydro-4,4-dimethyl-α-pyrone
- 4,4-dimethyl-3,4-dihydro-2H-pyran-2-one
- 3,4-Dihydro-4,4-dimethyl-2H-pyran-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
