CAS 769-30-2

1,3-benzodioxol-4-ylmethanol

Description:

1,3-Benzodioxol-4-ylmethanol, with the CAS number 769-30-2, is an organic compound characterized by its benzodioxole structure, which consists of a fused dioxole ring and a benzene ring. This compound features a hydroxymethyl group (-CH2OH) attached to the benzodioxole moiety, contributing to its reactivity and potential applications in various chemical reactions. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the hydroxymethyl group allows for hydrogen bonding, which can influence its solubility in polar solvents. 1,3-Benzodioxol-4-ylmethanol is of interest in organic synthesis and may serve as a precursor or intermediate in the production of pharmaceuticals, agrochemicals, or other fine chemicals. Its unique structure also makes it a subject of study in medicinal chemistry, particularly for its potential biological activities. As with many organic compounds, proper handling and safety precautions are essential due to its chemical properties.

Formula: C₈H₈O₃

InChI: InChI=1/C8H8O3/c9-4-6-2-1-3-7-8(6)11-5-10-7/h1-3,9H,4-5H2

SMILES: c1cc(CO)c2c(c1)OCO2

Synonyms:

• 1,3-Benzodioxole-4-Methanol
• 1,3-BENZODIOXOL-4-YLMETHANOL

Benzo[d][1,3]dioxol-4-ylmethanol

CAS: 769-30-2

Formula: C₈H₈O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 152.1473

Ref: IN-DA008OJ1

4-(Hydroxymethyl)-1,3-benzodioxole

CAS: 769-30-2

4-(Hydroxymethyl)-1,3-benzodioxole

Color and Shape: Solid

Molecular weight: 152.15g/mol

Ref: 54-OR23020

Benzo[d][1,3]dioxol-4-ylmethanol

CAS: 769-30-2

Formula: C₈H₈O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 152.149

Ref: 10-F222041

Tadalafil Impurity 11

CAS: 769-30-2

Formula: C₈H₈O₃

Molecular weight: 152.1

Ref: ST-EA-CP-T31031