CAS 769-51-7
:2-amino-4-methylpyrimidine-5-carboxylic acid
Description:
2-Amino-4-methylpyrimidine-5-carboxylic acid, with the CAS number 769-51-7, is an organic compound that features a pyrimidine ring substituted with an amino group and a carboxylic acid. This compound is characterized by its heterocyclic structure, which includes nitrogen atoms in the ring, contributing to its basicity and potential reactivity. The presence of the amino group (-NH2) makes it a basic compound, while the carboxylic acid group (-COOH) imparts acidic properties. This dual functionality allows it to participate in various chemical reactions, including those typical of amino acids and carboxylic acids. It is often used in biochemical research and synthesis, particularly in the study of nucleic acids and as a building block in pharmaceuticals. The compound is typically soluble in polar solvents, and its stability can be influenced by pH and temperature. Overall, 2-amino-4-methylpyrimidine-5-carboxylic acid is an important compound in organic chemistry with applications in medicinal chemistry and biochemistry.
Formula:C6H7N3O2
InChI:InChI=1/C6H7N3O2/c1-3-4(5(10)11)2-8-6(7)9-3/h2H,1H3,(H,10,11)(H2,7,8,9)
SMILES:Cc1c(c[nH]c(=N)n1)C(=O)O
Synonyms:- 5-Pyrimidinecarboxylic acid, 2-amino-4-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Amino-4-methylpyrimidine-5-carboxylic acid
CAS:Formula:C6H7N3O2Purity:97%Color and Shape:SolidMolecular weight:153.13872-Amino-4-methylpyrimidine-5-carboxylic acid
CAS:<p>2-Amino-4-methylpyrimidine-5-carboxylic acid</p>Formula:C6H7N3O2Purity:95%Color and Shape: off-white solidMolecular weight:153.14g/mol2-Amino-4-methyl-pyrimidine-5-carboxylic acid
CAS:Formula:C6H7N3O2Purity:97%Color and Shape:SolidMolecular weight:153.1412-Amino-4-methyl-pyrimidine-5-carboxylic acid
CAS:<p>2-Amino-4-methyl-pyrimidine-5-carboxylic acid is a spleen cell immunogen that induces antibody production in animals. 2-Amino-4-methyl-pyrimidine-5-carboxylic acid is an immunogen that belongs to the class of pyrimidine carboxylic acids. It has been optimised for use as an animal vaccine by inoculating it into tissues and monitoring antibody production with an enzyme linked immunosorbent assay. This compound has also been used to monitor and screen for antibodies in liquid chromatography.</p>Formula:C6H7N3O2Purity:Min. 95%Molecular weight:153.14 g/mol





