CAS 769-54-0

Pyridine, 3-fluoro-4-nitro-, 1-oxide

Description:

Pyridine, 3-fluoro-4-nitro-, 1-oxide, also known by its CAS number 769-54-0, is a heterocyclic organic compound characterized by a pyridine ring with a nitro group and a fluorine atom substituted at specific positions. This compound features a nitrogen atom within a six-membered aromatic ring, contributing to its basicity and potential reactivity. The presence of the nitro group typically enhances the electrophilic character of the molecule, making it useful in various chemical reactions, including nitration and substitution processes. The fluorine atom can influence the compound's polarity and solubility, affecting its interactions with other substances. Pyridine derivatives are often utilized in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. Additionally, the 1-oxide designation indicates the presence of an oxygen atom bonded to the nitrogen, which can affect the compound's stability and reactivity. Overall, this compound exhibits unique properties that make it valuable in both industrial and research applications.

Formula: C₅H₃FN₂O₃

InChI: InChI=1S/C5H3FN2O3/c6-4-3-7(9)2-1-5(4)8(10)11/h1-3H

InChI key: InChIKey=QHWIGULJOZAPAQ-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C(F)=CN(=O)=CC1

Synonyms:

• 3-Fluoro-4-Nitropyridine-N-Oxide
• 3-Fluoro-4-nitro-1-oxidopyridin-1-ium
• 3-Fluoro-4-nitropyridin-1-ium-1-olate
• Pyridine, 3-fluoro-4-nitro-, 1-oxide
• 3-Fluoro-4-nitropyridine 1-oxide

3-Fluoro-4-nitropyridine 1-oxide

CAS: 769-54-0

Formula: C₅H₃FN₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 158.0873

Ref: IN-DA003JGG

3-Fluoro-4-nitropyridine-N-oxide

CAS: 769-54-0

3-Fluoro-4-nitropyridine-N-oxide

Formula: C₅H₃FN₂O₃

Purity: 98%

Color and Shape: faint yellow crystalline needles

Molecular weight: 158.09g/mol

Ref: 54-PC53338

3-Fluoro-4-nitropyridine N-oxide

CAS: 769-54-0

Formula: C₅H₃FN₂O₃

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 158.088

Ref: 10-F076846