CAS 769-57-3
:(1,2-Dimethyl-1-propen-1-yl)benzene
Description:
(1,2-Dimethyl-1-propen-1-yl)benzene, also known as p-cymene, is an aromatic hydrocarbon characterized by its structure, which features a benzene ring substituted with a propenyl group and two methyl groups. This compound is a colorless liquid at room temperature and possesses a distinctive sweet, citrus-like aroma, making it notable in the fragrance and flavor industry. It is soluble in organic solvents but has limited solubility in water. p-Cymene is known for its role as a precursor in the synthesis of various chemicals and is also found naturally in essential oils, such as those derived from thyme and cumin. Its chemical properties include a relatively low boiling point and a moderate vapor pressure, indicating volatility. Additionally, p-cymene exhibits some antimicrobial properties, which have led to its exploration in various applications, including food preservation and as a potential therapeutic agent. Safety data indicates that while it is generally regarded as safe in low concentrations, it should be handled with care due to potential irritant effects.
Formula:C11H14
InChI:InChI=1S/C11H14/c1-9(2)10(3)11-7-5-4-6-8-11/h4-8H,1-3H3
InChI key:InChIKey=ZTHJQCDAHYOPIK-UHFFFAOYSA-N
SMILES:C(=C(C)C)(C)C1=CC=CC=C1
Synonyms:- Benzene, (1,2-dimethyl-1-propenyl)-
- 2-Butene, 2-methyl-3-phenyl-
- Benzene, (1,2-dimethyl-1-propen-1-yl)-
- (1,2-Dimethyl-1-propen-1-yl)benzene
- α,β,β-Trimethylstyrene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(3-Methylbut-2-en-2-yl)benzene
CAS:<p>(3-Methylbut-2-en-2-yl)benzene is a cyclopentyl compound with a hydrophilized molecule. It has an acidic nature and can be used as a crosslinker, linking amino acids together to form polymers. (3-Methylbut-2-en-2-yl)benzene can also be used as a linker in the synthesis of linear polymers, which are made up of repeating units. This chemical reacts with hydroxyl groups to form esters and amides. (3-Methylbut-2-en-2-yl)benzene is used as a polymerization initiator in organic solvents to produce linear polymers that have functional groups on the end of each molecule. The number of daltons in this chemical determines its solubility in water.</p>Formula:C11H14Purity:Min. 95%Molecular weight:146.23 g/mol
