CAS 769-97-1

2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxamide

Description:

2,6-Dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxamide, with the CAS number 769-97-1, is a heterocyclic organic compound characterized by its pyrimidine ring structure, which contains both carbonyl (C=O) and amide (C=O-NH2) functional groups. This compound typically appears as a crystalline solid and is soluble in polar solvents due to the presence of the carboxamide group, which can engage in hydrogen bonding. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmaceutical research. The compound may exhibit properties such as antimicrobial or antitumor activity, although specific biological effects would depend on further empirical studies. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxamide serves as a valuable compound in various chemical and biological applications.

Formula: C₅H₅N₃O₃

InChI: InChI=1/C5H5N3O3/c6-4(10)2-1-3(9)8-5(11)7-2/h1H,(H2,6,10)(H2,7,8,9,11)

SMILES: c1c(C(=N)O)nc(nc1O)O

4-Pyrimidinecarboxamide,1,2,3,6-tetrahydro-2,6-dioxo-

CAS: 769-97-1

Formula: C₅H₅N₃O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 155.1115

Ref: IN-DA005EQL

2,6-Dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxamide

CAS: 769-97-1

2,6-Dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxamide

Purity: 97%

Molecular weight: 155.11g/mol

Ref: 54-OR1058488

2,6-Dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxamide

CAS: 769-97-1

2,6-Dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxamide (DOTPC) is a monomer that can be used to stabilize duplexed and triplexed nucleic acid structures. DOTPC binds to the amine groups in RNA and DNA molecules, which stabilizes the structure of nucleic acids by preventing the formation of undesirable hydrogen bonds between nucleotides. The compound has been shown to be effective in hybridizing duplexes and triplexes with complementary strands containing uracil or thymine bases. DOTPC is synthesized from orotic acid by reacting it with an amine in a carboxamide reaction.

Formula: C₅H₅N₃O₃

Purity: Min. 95%

Molecular weight: 155.11 g/mol

Ref: 3D-AAA76997