CAS 76902-32-4
:N-ethyl-2-methylbenzenesulfonamide - N-ethyl-4-methylbenzenesulfonamide (1:1)
Description:
N-ethyl-2-methylbenzenesulfonamide and N-ethyl-4-methylbenzenesulfonamide are sulfonamide compounds characterized by the presence of a sulfonamide functional group (-SO2NH2) attached to aromatic rings. The compound with CAS number 76902-32-4 is a mixture of these two isomers in a 1:1 ratio. These substances typically exhibit moderate solubility in polar solvents due to the presence of the sulfonamide group, while their aromatic structures contribute to hydrophobic characteristics. They may display biological activity, particularly as antimicrobial agents, owing to the sulfonamide moiety, which is known for its role in inhibiting bacterial folic acid synthesis. The melting and boiling points of such compounds can vary based on their specific molecular structure and intermolecular interactions. Additionally, they may be sensitive to light and moisture, necessitating proper storage conditions. Safety data sheets should be consulted for handling and toxicity information, as sulfonamides can cause allergic reactions in some individuals.
Formula:C17H24N2O4S2
InChI:InChI=1/2C9H13NO2S/c1-3-10-13(11,12)9-6-4-8(2)5-7-9;1-3-10-13(11,12)9-7-5-4-6-8(9)2/h2*4-7,10H,3H2,1-2H3
SMILES:CCNS(=O)(=O)c1ccc(C)cc1.CCNS(=O)(=O)c1ccccc1C
Synonyms:- benzenesulfonamide, N-ethyl-2-methyl-, compd. with N-ethyl-4-methylbenzenesulfonamide (1:1)
- N-Ethyl-2-methylbenzenesulfonamide - N-ethyl-4-methylbenzenesulfonamide (1:1)
- N-Ethyltoluenesulfonamide(o-andp-mixture)>
- N-Ethyl-2-MethylbenzenesulfonaMide Mixture with N-Ethyl-4-MethylbenzenesulfonaMide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
N-Ethyltoluenesulfonamide (o- and p- mixture)
CAS:Formula:C18H26N2O4S2Purity:98%Color and Shape:LiquidMolecular weight:398.5400N-Ethyltoluenesulfonamide(o and p mixture)
CAS:Controlled ProductApplications The compounds exhibit the ability to inhibit tumor growth, shrink (i.e., necrotize) tumors, and prevent tumor formation in humans.
References Romero, A., et al.: Bioorg. Med. Chem. Lett., 2, 1703 (1992), Nagasawa, H., et al.: J. Med. Chem., 38, 1865 (1995),Formula:C9H13NO2SColor and Shape:NeatMolecular weight:199.27N-Ethyltoluenesulfonamide (o- and p- mixture)
CAS:Formula:C9H13NO2SPurity:>98.0%(N)Color and Shape:White - Yellow LiquidMolecular weight:199.27


