CAS 769099-80-1
:2-(4-fluorobenzyl)-2,5-diazabicyclo[2.2.1]heptane
Description:
2-(4-Fluorobenzyl)-2,5-diazabicyclo[2.2.1]heptane is a bicyclic organic compound characterized by its unique bicyclic structure, which consists of a heptane framework with two nitrogen atoms incorporated into the ring system. The presence of a 4-fluorobenzyl group enhances its lipophilicity and may influence its biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting the central nervous system, due to the diazabicyclo framework that can mimic certain neurotransmitter systems. The fluorine substituent can also modulate the compound's electronic properties, potentially affecting its interaction with biological targets. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacological properties and potential applications.
Formula:C12H15FN2
InChI:InChI=1/C12H15FN2/c13-10-3-1-9(2-4-10)7-15-8-11-5-12(15)6-14-11/h1-4,11-12,14H,5-8H2
SMILES:c1cc(ccc1CN1CC2CC1CN2)F
Synonyms:- 2,5-Diazabicyclo[2.2.1]Heptane, 2-[(4-Fluorophenyl)Methyl]-
- 2-(4-Fluorobenzyl)-2,5-diazabicyclo[2.2.1]heptane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.