CAS 769132-77-6

1-Methyl-3-(2-methylpropyl)-1H-pyrazole-5-carboxylic acid

Description:

1-Methyl-3-(2-methylpropyl)-1H-pyrazole-5-carboxylic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the methyl and 2-methylpropyl substituents enhances its lipophilicity, which may influence its solubility and biological activity. Typically, compounds like this can exhibit various properties such as being a potential ligand in coordination chemistry or serving as an intermediate in organic synthesis. The specific arrangement of substituents can also affect its pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's stability, melting point, and solubility in different solvents would depend on its molecular interactions and the nature of the substituents. Overall, 1-Methyl-3-(2-methylpropyl)-1H-pyrazole-5-carboxylic acid represents a unique structure with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₉H₁₄N₂O₂

InChI: InChI=1S/C9H14N2O2/c1-6(2)4-7-5-8(9(12)13)11(3)10-7/h5-6H,4H2,1-3H3,(H,12,13)

InChI key: InChIKey=FNZPEHCXMGHUNY-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(CC(C)C)=NN1C

Synonyms:

• 1H-pyrazole-5-carboxylic acid, 1-methyl-3-(2-methylpropyl)-
• 2-Methyl-5-(2-methylpropyl)pyrazole-3-carboxylic acid
• 3-Isobutyl-1-methyl-1H-pyrazole-5-carboxylic acid
• 1-Methyl-3-(2-methylpropyl)-1H-pyrazole-5-carboxylic acid

3-Isobutyl-1-methyl-1H-pyrazole-5-carboxylic acid

CAS: 769132-77-6

Formula: C₉H₁₄N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 182.2197

Ref: IN-DA005RVJ

3-Isobutyl-1-methyl-1H-pyrazole-5-carboxylic acid

CAS: 769132-77-6

3-Isobutyl-1-methyl-1H-pyrazole-5-carboxylic acid

Purity: 98%

Molecular weight: 182.22g/mol

Ref: 54-OR90413

3-Isobutyl-1-methyl-1H-pyrazole-5-carboxylic acid

CAS: 769132-77-6

Formula: C₉H₁₄N₂O₂

Purity: 97%

Color and Shape: Solid, Crystalline

Molecular weight: 182.223

Ref: 10-F058934

3-Isobutyl-1-methyl-1H-pyrazole-5-carboxylic Acid

Controlled Product

CAS: 769132-77-6

Applications 3-isobutyl-1-methyl-1H-pyrazole-5-carboxylic acid (cas# 769132-77-6) is a useful research chemical.

Formula: C₉H₁₄N₂O₂

Color and Shape: Neat

Molecular weight: 182.22

Ref: TR-B448783