CAS 769163-29-3

4-Chloro-2-[(phenylmethyl)thio]pyridine

Description:

4-Chloro-2-[(phenylmethyl)thio]pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 4-position and a phenylmethylthio group at the 2-position contributes to its unique chemical properties. This compound typically exhibits moderate to high lipophilicity due to the aromatic phenyl group, which can influence its solubility in organic solvents. The thioether functional group enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the chlorine substituent can participate in electrophilic aromatic substitution reactions. 4-Chloro-2-[(phenylmethyl)thio]pyridine may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific applications and reactivity can vary based on the context of use, including potential roles in synthesis or as a pharmacophore in drug design. Safety and handling precautions should be observed due to the presence of chlorine and the potential toxicity of the compound.

Formula: C₁₂H₁₀ClNS

InChI: InChI=1S/C12H10ClNS/c13-11-6-7-14-12(8-11)15-9-10-4-2-1-3-5-10/h1-8H,9H2

InChI key: InChIKey=FSXKFQLFOMJIFE-UHFFFAOYSA-N

SMILES: S(CC1=CC=CC=C1)C2=CC(Cl)=CC=N2

Synonyms:

• 4-Chloro-2-[(phenylmethyl)thio]pyridine
• 2-(Benzylthio)-4-chloropyridine
• Pyridine, 4-chloro-2-[(phenylmethyl)thio]-

2-(Benzylthio)-4-chloropyridine

CAS: 769163-29-3

Formula: C₁₂H₁₀ClNS

Molecular weight: 235.7325

Ref: IN-DA00GCR8