CymitQuimica logo

CAS 769163-30-6

:

4-Bromo-2-(methylthio)pyridine

Description:
4-Bromo-2-(methylthio)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 4-position and a methylthio group at the 2-position contributes to its unique chemical properties. This compound is typically a colorless to light yellow liquid or solid, depending on its form and purity. It is soluble in organic solvents, making it useful in various chemical reactions and applications, particularly in the synthesis of pharmaceuticals and agrochemicals. The bromine substituent can participate in nucleophilic substitution reactions, while the methylthio group can influence the compound's reactivity and polarity. Additionally, 4-Bromo-2-(methylthio)pyridine may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling and disposal measures should be followed in laboratory settings.
Formula:C6H6BrNS
InChI:InChI=1S/C6H6BrNS/c1-9-6-4-5(7)2-3-8-6/h2-4H,1H3
InChI key:InChIKey=SZHVGJPPMGZGNJ-UHFFFAOYSA-N
SMILES:S(C)C1=CC(Br)=CC=N1
Synonyms:
  • Pyridine, 4-bromo-2-(methylthio)-
  • 4-Bromo-2-(methylthio)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.