CAS 76923-15-4
:methyl 5-methyl-3-phenyl-1H-pyrazole-4-carboxylate
Description:
Methyl 5-methyl-3-phenyl-1H-pyrazole-4-carboxylate, identified by its CAS number 76923-15-4, is an organic compound characterized by its pyrazole core structure, which is a five-membered ring containing two nitrogen atoms. This compound features a methyl group and a phenyl group, contributing to its unique chemical properties and potential applications. It is typically a white to off-white crystalline solid, soluble in organic solvents, and exhibits moderate stability under standard conditions. The presence of the carboxylate functional group enhances its reactivity, making it a candidate for various chemical reactions, including esterification and nucleophilic substitutions. Methyl 5-methyl-3-phenyl-1H-pyrazole-4-carboxylate may also exhibit biological activity, which has led to interest in its potential use in pharmaceuticals or agrochemicals. As with many organic compounds, handling should be done with care, following appropriate safety protocols to mitigate any risks associated with its use.
Formula:C12H12N2O2
InChI:InChI=1/C12H12N2O2/c1-8-10(12(15)16-2)11(14-13-8)9-6-4-3-5-7-9/h3-7H,1-2H3,(H,13,14)
SMILES:Cc1c(c(c2ccccc2)n[nH]1)C(=O)OC
Synonyms:- 3-Methyl-5-phenyl-1H-pyrazole-4-carboxylic acid methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.