CymitQuimica logo

CAS 76926-16-4

:

2-Cyanomethyl N-Methyl-N-phenyldithiocarbamate

Description:
2-Cyanomethyl N-Methyl-N-phenyldithiocarbamate, with the CAS number 76926-16-4, is a chemical compound that belongs to the class of dithiocarbamates. This substance typically exhibits characteristics such as being a solid at room temperature, with a potential for low solubility in water but higher solubility in organic solvents. It features a dithiocarbamate functional group, which is known for its ability to form complexes with metal ions, making it useful in various applications, including agriculture as a pesticide or fungicide. The presence of the cyanomethyl group may impart additional reactivity, allowing for further chemical transformations. Safety data indicates that it should be handled with care, as it may pose risks such as toxicity or environmental hazards. Proper storage conditions are essential to maintain its stability and efficacy. Overall, this compound is of interest in both industrial and research settings due to its unique chemical properties and potential applications.
Formula:C10H10N2S2
InChI:InChI=1S/C10H10N2S2/c1-12(10(13)14-8-7-11)9-5-3-2-4-6-9/h2-6H,8H2,1H3
InChI key:FYACMHCOSCVNHO-UHFFFAOYSA-N
SMILES:CN(C1=CC=CC=C1)C(=S)SCC#N
Found 8 products.