CAS 76928-37-5

6,8-Dibromo-1,4-dihydro-2H-3,1-benzoxazin-2-one

Description:

6,8-Dibromo-1,4-dihydro-2H-3,1-benzoxazin-2-one is a chemical compound characterized by its unique structure, which includes a benzoxazine ring system. This compound features two bromine atoms substituted at the 6 and 8 positions of the benzoxazine, contributing to its reactivity and potential applications in various fields, including materials science and pharmaceuticals. The presence of the dihydro group indicates that it exists in a reduced form, which can influence its chemical behavior and stability. The compound is typically synthesized through specific organic reactions that involve bromination and cyclization processes. Its properties may include moderate solubility in organic solvents and potential biological activity, making it of interest for further research. As with many brominated compounds, it may exhibit unique electronic properties due to the halogen substituents, which can affect its interactions in chemical reactions. Safety and handling precautions are essential when working with this compound, as brominated substances can pose environmental and health risks.

Formula: C₈H₅Br₂NO₂

InChI: InChI=1S/C8H5Br2NO2/c9-5-1-4-3-13-8(12)11-7(4)6(10)2-5/h1-2H,3H2,(H,11,12)

InChI key: InChIKey=RQJFMNQNCRVVFJ-UHFFFAOYSA-N

SMILES: BrC1=C2C(=CC(Br)=C1)COC(=O)N2

Synonyms:

• 6,8-Dibromo-1,4-dihydro-2H-3,1-benzoxazin-2-one
• 2H-3,1-Benzoxazin-2-one, 6,8-dibromo-1,4-dihydro-