CAS 7693-45-0
:4-chlorophenyl chloroformate
Description:
4-Chlorophenyl chloroformate, with the CAS number 7693-45-0, is an organic compound characterized by its chloroformate functional group attached to a 4-chlorophenyl moiety. This compound typically appears as a colorless to pale yellow liquid and has a pungent odor. It is known for its reactivity, particularly as an acylating agent, making it useful in organic synthesis for the formation of esters and amides. The presence of the chloroformate group imparts significant electrophilic character, allowing it to react with nucleophiles such as alcohols and amines. Additionally, 4-chlorophenyl chloroformate is sensitive to moisture and can hydrolyze in the presence of water, releasing hydrochloric acid and forming the corresponding carboxylic acid. Safety precautions are essential when handling this compound, as it can be corrosive and harmful if inhaled or if it comes into contact with skin. Proper storage in a cool, dry place, away from moisture and incompatible substances, is recommended to maintain its stability and reactivity.
Formula:C7H4Cl2O2
InChI:InChI=1/C7H4Cl2O2/c8-5-1-3-6(4-2-5)11-7(9)10/h1-4H
SMILES:c1cc(ccc1Cl)OC(=O)Cl
Synonyms:- -p-Chlorophenyl chloroformate
- 4-Chlorophenyl chloridocarbonate
- 4-Chlorophenyl Carbonochloridate
- 4-CHLOROPHENYL CHLOROFORMATE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Chlorophenyl carbonochloridate
CAS:Formula:C7H4Cl2O2Purity:95%Color and Shape:LiquidMolecular weight:191.01154-Chlorophenyl chloroformate
CAS:4-Chlorophenyl chloroformateFormula:C7H4Cl2O2Purity:≥95%Color and Shape: clear. colourless liquidMolecular weight:191.01g/mol4-Chlorophenyl Chloroformate
CAS:Formula:C7H4Cl2O2Purity:>98.0%(GC)(T)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:191.014-Chlorophenyl carbonochloridate
CAS:Formula:C7H4Cl2O2Purity:98%;RGColor and Shape:LiquidMolecular weight:191.014-Chlorophenyl Chloroformate
CAS:4-Chlorophenyl Chloroformate is a chlorinating agent that has been shown to increase intracellular levels of carbon sources. It also has been shown to selectively act on the phenyl group of histidine and amines. 4-Chlorophenyl Chloroformate can be used as a synthetic intermediate in the synthesis of other compounds, including antidiabetic agents.Formula:C7H4Cl2O2Purity:Min. 95%Molecular weight:191.01 g/mol




