CAS 76935-66-5

3,4,5-Trimethylbenzeneethanamine

Description:

3,4,5-Trimethylbenzeneethanamine, also known as a derivative of phenethylamine, is an organic compound characterized by its amine functional group attached to a benzene ring that has three methyl substituents at the 3, 4, and 5 positions. This structure contributes to its unique chemical properties, including its potential as a building block in organic synthesis and its applications in various chemical industries. The presence of the amine group imparts basicity to the compound, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. Additionally, the bulky methyl groups can influence the compound's steric properties, affecting its reactivity and interaction with other molecules. The compound may exhibit moderate solubility in organic solvents, while its behavior in aqueous environments can vary based on pH and concentration. Safety data should be consulted for handling and storage, as amines can be hazardous. Overall, 3,4,5-Trimethylbenzeneethanamine is of interest in both academic research and industrial applications.

Formula: C₁₁H₁₇N

InChI: InChI=1S/C11H17N/c1-8-6-11(4-5-12)7-9(2)10(8)3/h6-7H,4-5,12H2,1-3H3

InChI key: InChIKey=KAUIOBNOAIVCQQ-UHFFFAOYSA-N

SMILES: C(CN)C1=CC(C)=C(C)C(C)=C1

Synonyms:

• 3,4,5-Trimethylbenzeneethanamine
• Benzeneethanamine, 3,4,5-trimethyl-
• 2-(3,4,5-Trimethylphenyl)ethan-1-amine