CAS 7694-30-6
:1,1'-(1R,2S)-cyclobutane-1,2-diyldibenzene
Description:
1,1'-(1R,2S)-cyclobutane-1,2-diyldibenzene, with the CAS number 7694-30-6, is an organic compound characterized by its unique bicyclic structure that incorporates a cyclobutane ring connected to two benzene rings. This compound exhibits a rigid, planar conformation due to the presence of the cyclobutane moiety, which influences its chemical reactivity and physical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The stereochemistry indicated by the (1R,2S) notation suggests specific spatial arrangements of substituents, which can affect its interactions and reactivity in chemical reactions. This compound may be of interest in materials science and organic synthesis due to its potential applications in creating novel polymers or as a building block in more complex organic molecules. Its properties, such as melting point, boiling point, and spectral characteristics, would be determined through experimental methods and can vary based on purity and environmental conditions.
Formula:C16H16
InChI:InChI=1/C16H16/c1-3-7-13(8-4-1)15-11-12-16(15)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2/t15-,16+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.