CymitQuimica logo

CAS 76942-21-7

:

3-Bromo-5-chloro-2,6-pyridinediamine

Description:
3-Bromo-5-chloro-2,6-pyridinediamine, with the CAS number 76942-21-7, is a chemical compound that belongs to the class of pyridine derivatives. It features a pyridine ring substituted with both bromine and chlorine atoms, as well as two amino groups. This compound is characterized by its potential use in various applications, including pharmaceuticals and agrochemicals, due to the presence of functional groups that can participate in further chemical reactions. The bromine and chlorine substituents can influence the compound's reactivity, solubility, and biological activity. Typically, compounds like this may exhibit properties such as moderate to high polarity, which can affect their interaction with biological systems. Additionally, the presence of amino groups suggests potential for hydrogen bonding, which can enhance solubility in polar solvents. Safety and handling considerations are important, as halogenated compounds can pose environmental and health risks. Overall, 3-Bromo-5-chloro-2,6-pyridinediamine is a versatile compound with significant implications in chemical research and development.
Formula:C5H5BrClN3
InChI:InChI=1S/C5H5BrClN3/c6-2-1-3(7)5(9)10-4(2)8/h1H,(H4,8,9,10)
InChI key:InChIKey=LKFQINOLOWLAOU-UHFFFAOYSA-N
SMILES:BrC1=C(N)N=C(N)C(Cl)=C1
Synonyms:
  • 3-Bromo-5-chloro-2,6-pyridinediamine
  • 2,6-Pyridinediamine, 3-bromo-5-chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.