CAS 7695-56-9
:(betaR)-beta-hydroxy-D-phenylalanine
Description:
(betaR)-beta-hydroxy-D-phenylalanine, also known as D-β-hydroxyphenylalanine, is an amino acid derivative characterized by its hydroxyl group attached to the beta carbon relative to the carboxylic acid functional group. This compound is a chiral molecule, with its specific stereochemistry influencing its biological activity and interactions. It is typically found in a crystalline form and is soluble in water, which is common for many amino acids and their derivatives. The presence of the phenyl group contributes to its aromatic characteristics, potentially affecting its reactivity and interactions in biological systems. This compound is of interest in biochemical research, particularly in studies related to neurotransmitter synthesis and metabolic pathways. Its unique structure allows it to participate in various chemical reactions, making it a valuable compound in synthetic organic chemistry and pharmaceutical applications. As with many amino acids, it may exhibit both hydrophilic and hydrophobic properties, influencing its behavior in different environments.
Formula:C9H11NO3
InChI:InChI=1/C9H11NO3/c10-7(9(12)13)8(11)6-4-2-1-3-5-6/h1-5,7-8,11H,10H2,(H,12,13)/t7-,8-/m1/s1
InChI key:InChIKey=VHVGNTVUSQUXPS-HGXVMFPFNA-N
SMILES:c1ccc(cc1)[C@H]([C@H](C(=O)O)N)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
DL-threo-β-Phenylserine
CAS:Controlled ProductApplications 2-amino-3-hydroxy-3-phenylpropanoic acid (cas# 7695-56-9) is a useful research chemical.
Formula:C9H11NO3Color and Shape:NeatMolecular weight:181.19
