CAS 76953-33-8

1-(6-chloropyridazin-3-yl)-1-methylhydrazine

Description:

1-(6-Chloropyridazin-3-yl)-1-methylhydrazine, with the CAS number 76953-33-8, is a chemical compound characterized by its hydrazine functional group and a chlorinated pyridazine moiety. This compound typically exhibits properties associated with hydrazines, such as being a colorless to light yellow liquid or solid, depending on its physical state at room temperature. It is known for its potential reactivity, particularly in forming coordination complexes and participating in various organic reactions, including hydrazone formation. The presence of the chloropyridazine ring contributes to its unique electronic properties, which may influence its reactivity and interactions with biological systems. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical research. Safety considerations are important, as hydrazines can be toxic and potentially carcinogenic, necessitating careful handling and storage. Overall, 1-(6-chloropyridazin-3-yl)-1-methylhydrazine is a compound of interest in both synthetic chemistry and medicinal applications.

Formula: C₅H₇ClN₄

InChI: InChI=1/C5H7ClN4/c1-10(7)5-3-2-4(6)8-9-5/h2-3H,7H2,1H3

SMILES: CN(c1ccc(Cl)nn1)N

Synonyms:

• 3-Chloro-6-(1-Methylhydrazino)Pyridazine

N-(3-Chloropyridazin-6-yl)-N-methylhydrazine

CAS: 76953-33-8

N-(3-Chloropyridazin-6-yl)-N-methylhydrazine

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 158.59g/mol

Ref: 54-OR4821

N-(3-Chloropyridazin-6-yl)-N-methylhydrazine

CAS: 76953-33-8

Formula: C₅H₇ClN₄

Purity: 95.0%

Molecular weight: 158.59

Ref: 10-F017149