CAS 76958-07-1

6-chloro-1,3-benzodioxol-5-amine

Description:

6-Chloro-1,3-benzodioxol-5-amine is an organic compound characterized by its benzodioxole structure, which consists of a fused dioxole ring and an amine group. The presence of a chlorine atom at the 6-position of the benzodioxole ring contributes to its reactivity and potential biological activity. This compound is typically a white to off-white solid and is soluble in polar organic solvents. It may exhibit properties such as being a potential intermediate in the synthesis of pharmaceuticals or agrochemicals. The amine functional group can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Due to its structural features, it may also interact with biological systems, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as with any chemical, to ensure proper precautions are taken. Overall, 6-chloro-1,3-benzodioxol-5-amine is a compound of interest in both synthetic and medicinal chemistry contexts.

Formula: C₇H₆ClNO₂

InChI: InChI=1/C7H6ClNO2/c8-4-1-6-7(2-5(4)9)11-3-10-6/h1-2H,3,9H2

SMILES: c1c(c(cc2c1OCO2)N)Cl

Synonyms:

• 6-Chloro-benzo[1,3]dioxol-5-ylamine

6-CHLORO-1,3-BENZODIOXOL-5-AMINE

CAS: 76958-07-1

Formula: C₇H₆ClNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 171.5810

Ref: IN-DA0057PH

6-Chloro-1,3-benzodioxol-5-amine

CAS: 76958-07-1

6-Chloro-1,3-benzodioxol-5-amine

Purity: 98%

Molecular weight: 171.58g/mol

Ref: 54-OR953510

6-Chloro-benzo[1,3]dioxol-5-ylamine

CAS: 76958-07-1

Formula: C₇H₆ClNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 171.58

Ref: 10-F058884

6-Chloro-1,3-benzodioxol-5-amine

CAS: 76958-07-1

Versatile small molecule scaffold

Formula: C₇H₆ClNO₂

Purity: Min. 95%

Molecular weight: 171.58 g/mol

Ref: 3D-BDA95807