CAS 76958-67-3
:(1aR,3Z,13S,14S,15aR)-9,13,14-trihydroxy-11-methoxy-6-methyl-5,6,13,14,15,15a-hexahydro-2H-oxireno[h][2]benzoxacyclotetradecine-2,8(1aH)-dione
Description:
The chemical substance with the name "(1aR,3Z,13S,14S,15aR)-9,13,14-trihydroxy-11-methoxy-6-methyl-5,6,13,14,15,15a-hexahydro-2H-oxireno[h][2]benzoxacyclotetradecine-2,8(1aH)-dione" and CAS number "76958-67-3" is a complex organic compound characterized by its unique stereochemistry and functional groups. It features multiple hydroxyl (-OH) groups, which contribute to its potential solubility in polar solvents and its reactivity in various chemical reactions. The presence of a methoxy (-OCH3) group indicates potential for methylation reactions, while the hexahydro structure suggests it may exhibit a degree of saturation, influencing its stability and reactivity. The compound's intricate ring structure, including an oxirane (epoxide) moiety, may impart unique properties such as strain and reactivity towards nucleophiles. Overall, this compound's specific arrangement of atoms and functional groups suggests potential applications in medicinal chemistry, particularly in the development of bioactive molecules or as intermediates in organic synthesis. Further studies would be necessary to elucidate its full chemical behavior and potential applications.
Formula:C19H22O8
InChI:InChI=1/C19H22O8/c1-9-4-3-5-12(20)18-15(27-18)8-14(22)17(23)11-6-10(25-2)7-13(21)16(11)19(24)26-9/h3,5-7,9,14-15,17-18,21-23H,4,8H2,1-2H3/b5-3-/t9?,14-,15+,17-,18-/m0/s1
Synonyms:- Hypothemycin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Hypothemycin
CAS:<p>Hypothemycin is a natural product that serves as a potent inhibitor of protein kinases. It is derived from the fungus Hypomyces subiculosus and belongs to the class of resorcylic acid lactones. Its mode of action involves binding covalently to the ATP-binding site of kinases, leading to the inhibition of their activity. This covalent modification is achieved through the formation of a Michael-type addition with a reactive ene-diene functionality within its structure. By targeting these critical enzymes, hypothemycin disrupts key signaling pathways that are essential for cell growth and proliferation.</p>Purity:Min. 95%Hypothemycin
CAS:Hypothemycin, a fungal polyketide, inhibits multiple kinases (VEGFR, MEK, FLT-3, PDGFR, ERK) with Kis ranging from 10 nM to 2.4 μM.Formula:C19H22O8Purity:98%Color and Shape:SolidMolecular weight:378.37




