CAS 76962-34-0

3-(perfluorooctyl)-2-hydroxypropyl acrylate

Description:

3-(Perfluorooctyl)-2-hydroxypropyl acrylate, with the CAS number 76962-34-0, is a fluorinated acrylate compound characterized by the presence of a perfluorinated octyl group, which imparts unique properties such as hydrophobicity and oleophobicity. This compound features a hydroxypropyl group that enhances its compatibility with various substrates and contributes to its reactivity in polymerization processes. The acrylate functional group allows for easy incorporation into polymer matrices through free radical polymerization, making it valuable in coatings, adhesives, and surface modification applications. The presence of fluorinated chains typically results in increased thermal stability and chemical resistance, while also providing low surface energy characteristics. These properties make it suitable for applications in industries such as textiles, electronics, and automotive, where water and oil repellency are desired. However, due to the environmental concerns associated with perfluorinated compounds, its use may be subject to regulatory scrutiny, necessitating careful consideration of its application and disposal.

Formula: C₁₄H₉F₁₇O₃

InChI: InChI=1/C14H9F17O3/c1-2-6(33)34-4-5(32)3-7(15,16)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)13(27,28)14(29,30)31/h2,5,32H,1,3-4H2

SMILES: C=CC(=O)OCC(CC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O

Synonyms:

• 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoro-2-hydroxyundecyl acrylate
• 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoro-2-Hydroxyundecyl Prop-2-Enoate