CAS 7697-27-0
:2-Bromo-4-methylbenzoic acid
Description:
It appears there is a mix-up with the CAS number provided. The CAS number 7697-27-0 corresponds to nitric acid, not 2-Bromo-4-methylbenzoic acid. However, 2-Bromo-4-methylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and a methyl group on a benzoic acid structure. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, with limited solubility in water. It has a molecular formula of C9H9BrO2 and features a carboxylic acid functional group (-COOH), which imparts acidic properties. The bromine substituent can influence the compound's reactivity and potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the presence of the methyl group can affect the compound's steric and electronic properties, making it a useful intermediate in various chemical reactions. Always handle such substances with care, following appropriate safety protocols.
Formula:C8H7BrO2
InChI:InChI=1S/C8H7BrO2/c1-5-2-3-6(8(10)11)7(9)4-5/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=ZZYYOHPHSYCHQG-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Br)C=C(C)C=C1
Synonyms:- 2-Bromo-4-methylbenzoic acid
- Benzoic acid, 2-bromo-4-methyl-
- p-Toluic acid, 2-bromo-
- NSC 16629
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Bromo-4-methylbenzoic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H7BrO2Purity:97%Color and Shape:White to yellow, PowderMolecular weight:215.052-Bromo-4-methylbenzoic acid
CAS:Formula:C8H7BrO2Purity:97%Color and Shape:SolidMolecular weight:215.04402-Bromo-4-methylbenzoic acid
CAS:2-Bromo-4-methylbenzoic acidFormula:C8H7BrO2Purity:97%Color and Shape: white powderMolecular weight:215.04g/mol2-Bromo-4-methylbenzoic Acid
CAS:Formula:C8H7BrO2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:215.052-Bromo-4-methylbenzoic acid
CAS:Formula:C8H7BrO2Purity:98%Color and Shape:SolidMolecular weight:215.046





